C10H11F2N3O — CID 118836991
2-[2-(aminomethyl)-4-(difluoromethyl)-5-methoxy-3-pyridinyl]acetonitrile (PubChem CID 118836991) has the molecular formula C10H11F2N3O and a molecular weight of 227.21 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-4-(difluoromethyl)-5-methoxy-3-pyridinyl]acetonitrile.
| Compound Name | 2-[2-(aminomethyl)-4-(difluoromethyl)-5-methoxy-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118836991 |
| Molecular Formula | C10H11F2N3O |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-[2-(aminomethyl)-4-(difluoromethyl)-5-methoxy-3-pyridinyl]acetonitrile |
| SMILES | COc1cnc(CN)c(CC#N)c1C(F)F |
| InChI | InChI=1S/C10H11F2N3O/c1-16-8-5-15-7(4-14)6(2-3-13)9(8)10(11)12/h5,10H,2,4,14H2,1H3 |
| InChIKey | POUMNSPFMKRBOK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |