C8H9F3N2O — CID 118841033
[3-(difluoromethyl)-2-fluoro-5-methoxy-4-pyridinyl]methanamine (PubChem CID 118841033) has the molecular formula C8H9F3N2O and a molecular weight of 206.17 g/mol. Its IUPAC name is [3-(difluoromethyl)-2-fluoro-5-methoxy-4-pyridinyl]methanamine.
| Compound Name | [3-(difluoromethyl)-2-fluoro-5-methoxy-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 118841033 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | [3-(difluoromethyl)-2-fluoro-5-methoxy-4-pyridinyl]methanamine |
| SMILES | COc1cnc(F)c(C(F)F)c1CN |
| InChI | InChI=1S/C8H9F3N2O/c1-14-5-3-13-8(11)6(7(9)10)4(5)2-12/h3,7H,2,12H2,1H3 |
| InChIKey | GQGBITQBTKUQFU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|