C7H9F2N3O — CID 119019295
3-(difluoromethyl)-5-methoxypyridine-2,4-diamine (PubChem CID 119019295) has the molecular formula C7H9F2N3O and a molecular weight of 189.17 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-methoxypyridine-2,4-diamine.
| Compound Name | 3-(difluoromethyl)-5-methoxypyridine-2,4-diamine |
|---|---|
| PubChem CID | 119019295 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 3-(difluoromethyl)-5-methoxypyridine-2,4-diamine |
| SMILES | COc1cnc(N)c(C(F)F)c1N |
| InChI | InChI=1S/C7H9F2N3O/c1-13-3-2-12-7(11)4(5(3)10)6(8)9/h2,6H,1H3,(H4,10,11,12) |
| InChIKey | REZFBQTYOCTSMP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |