C8H7F5N2O2 — CID 118800001
3-(difluoromethyl)-5-methoxy-2-(trifluoromethoxy)pyridin-4-amine (PubChem CID 118800001) has the molecular formula C8H7F5N2O2 and a molecular weight of 258.15 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-methoxy-2-(trifluoromethoxy)pyridin-4-amine.
| Compound Name | 3-(difluoromethyl)-5-methoxy-2-(trifluoromethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 118800001 |
| Molecular Formula | C8H7F5N2O2 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 3-(difluoromethyl)-5-methoxy-2-(trifluoromethoxy)pyridin-4-amine |
| SMILES | COc1cnc(OC(F)(F)F)c(C(F)F)c1N |
| InChI | InChI=1S/C8H7F5N2O2/c1-16-3-2-15-7(17-8(11,12)13)4(5(3)14)6(9)10/h2,6H,1H3,(H2,14,15) |
| InChIKey | ALVQPUQFTLJNOV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |