C8H10F2N2O2 — CID 130100785
3-(difluoromethyl)-2,5-dimethoxypyridin-4-amine (PubChem CID 130100785) has the molecular formula C8H10F2N2O2 and a molecular weight of 204.18 g/mol. Its IUPAC name is 3-(difluoromethyl)-2,5-dimethoxypyridin-4-amine.
| Compound Name | 3-(difluoromethyl)-2,5-dimethoxypyridin-4-amine |
|---|---|
| PubChem CID | 130100785 |
| Molecular Formula | C8H10F2N2O2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-(difluoromethyl)-2,5-dimethoxypyridin-4-amine |
| SMILES | COc1cnc(OC)c(C(F)F)c1N |
| InChI | InChI=1S/C8H10F2N2O2/c1-13-4-3-12-8(14-2)5(6(4)11)7(9)10/h3,7H,1-2H3,(H2,11,12) |
| InChIKey | UNIDEQFGASTCBE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |