C8H8BrF2NO2 — CID 130100804
3-bromo-4-(difluoromethyl)-2,5-dimethoxypyridine (PubChem CID 130100804) has the molecular formula C8H8BrF2NO2 and a molecular weight of 268.06 g/mol. Its IUPAC name is 3-bromo-4-(difluoromethyl)-2,5-dimethoxypyridine.
| Compound Name | 3-bromo-4-(difluoromethyl)-2,5-dimethoxypyridine |
|---|---|
| PubChem CID | 130100804 |
| Molecular Formula | C8H8BrF2NO2 |
| Molecular Weight | 268.06 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | 3-bromo-4-(difluoromethyl)-2,5-dimethoxypyridine |
| SMILES | COc1cnc(OC)c(Br)c1C(F)F |
| InChI | InChI=1S/C8H8BrF2NO2/c1-13-4-3-12-8(14-2)6(9)5(4)7(10)11/h3,7H,1-2H3 |
| InChIKey | BIGFWIAOAWGFIY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.06 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |