C9H10ClF2NO2 — CID 130100950
4-(chloromethyl)-3-(difluoromethyl)-2,5-dimethoxypyridine (PubChem CID 130100950) has the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. Its IUPAC name is 4-(chloromethyl)-3-(difluoromethyl)-2,5-dimethoxypyridine.
| Compound Name | 4-(chloromethyl)-3-(difluoromethyl)-2,5-dimethoxypyridine |
|---|---|
| PubChem CID | 130100950 |
| Molecular Formula | C9H10ClF2NO2 |
| Molecular Weight | 237.63 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 4-(chloromethyl)-3-(difluoromethyl)-2,5-dimethoxypyridine |
| SMILES | COc1cnc(OC)c(C(F)F)c1CCl |
| InChI | InChI=1S/C9H10ClF2NO2/c1-14-6-4-13-9(15-2)7(8(11)12)5(6)3-10/h4,8H,3H2,1-2H3 |
| InChIKey | FRZNXRTZWUBXHX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.63 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|