C8H10F2N2O4S — CID 134670782
3-(difluoromethyl)-2,5-dimethoxypyridine-4-sulfonamide (PubChem CID 134670782) has the molecular formula C8H10F2N2O4S and a molecular weight of 268.24 g/mol. Its IUPAC name is 3-(difluoromethyl)-2,5-dimethoxypyridine-4-sulfonamide.
| Compound Name | 3-(difluoromethyl)-2,5-dimethoxypyridine-4-sulfonamide |
|---|---|
| PubChem CID | 134670782 |
| Molecular Formula | C8H10F2N2O4S |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3-(difluoromethyl)-2,5-dimethoxypyridine-4-sulfonamide |
| SMILES | COc1cnc(OC)c(C(F)F)c1S(N)(=O)=O |
| InChI | InChI=1S/C8H10F2N2O4S/c1-15-4-3-12-8(16-2)5(7(9)10)6(4)17(11,13)14/h3,7H,1-2H3,(H2,11,13,14) |
| InChIKey | RXUQVTGQYVZCHB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |