C7H7F3N2O3S — CID 118826041
2-(difluoromethyl)-4-fluoro-5-methoxypyridine-3-sulfonamide (PubChem CID 118826041) has the molecular formula C7H7F3N2O3S and a molecular weight of 256.20 g/mol. Its IUPAC name is 2-(difluoromethyl)-4-fluoro-5-methoxypyridine-3-sulfonamide.
| Compound Name | 2-(difluoromethyl)-4-fluoro-5-methoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118826041 |
| Molecular Formula | C7H7F3N2O3S |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-(difluoromethyl)-4-fluoro-5-methoxypyridine-3-sulfonamide |
| SMILES | COc1cnc(C(F)F)c(S(N)(=O)=O)c1F |
| InChI | InChI=1S/C7H7F3N2O3S/c1-15-3-2-12-5(7(9)10)6(4(3)8)16(11,13)14/h2,7H,1H3,(H2,11,13,14) |
| InChIKey | ACEIWGZQZYYJJD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |