methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate

C10H11F2NO4 — CID 134684678

IUPACmethyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate
SMILESCOC(=O)c1c(OC)ncc(OC)c1C(F)F
InChIInChI=1S/C10H11F2NO4/c1-15-5-4-13-9(16-2)7(10(14)17-3)6(5)8(11)12/h4,8H,1-3H3
InChIKeyCDRSYZHKPRTVCS-UHFFFAOYSA-N
MW247.20 g/mol
LogP1.82
Rot. Bonds4

About methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate

methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate (PubChem CID 134684678) has the molecular formula C10H11F2NO4 and a molecular weight of 247.20 g/mol. Its IUPAC name is methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate
PubChem CID134684678
Molecular FormulaC10H11F2NO4
Molecular Weight247.20 g/mol
Exact Mass247.07
IUPAC Namemethyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate
SMILESCOC(=O)c1c(OC)ncc(OC)c1C(F)F
InChIInChI=1S/C10H11F2NO4/c1-15-5-4-13-9(16-2)7(10(14)17-3)6(5)8(11)12/h4,8H,1-3H3
InChIKeyCDRSYZHKPRTVCS-UHFFFAOYSA-N
XLogP1.82
TPSA57.65 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.20
LogP ≤ 51.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate?
The IUPAC name of methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate (CID 134684678) is methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate.
What is the SMILES notation for methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate?
The canonical SMILES for methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate is COC(=O)c1c(OC)ncc(OC)c1C(F)F.
What is the InChIKey of methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate?
The InChIKey is CDRSYZHKPRTVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO4/c1-15-5-4-13-9(16-2)7(10(14)17-3)6(5)8(11)12/h4,8H,1-3H3.
What are the key properties of methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate?
methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate has a molecular weight of 247.20 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(difluoromethyl)-2,5-dimethoxypyridine-3-carboxylate is sourced from PubChem (CID 134684678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).