C8H10BrNO3 — CID 84706374
4-bromo-2,3,5-trimethoxypyridine (PubChem CID 84706374) has the molecular formula C8H10BrNO3 and a molecular weight of 248.08 g/mol. Its IUPAC name is 4-bromo-2,3,5-trimethoxypyridine.
| Compound Name | 4-bromo-2,3,5-trimethoxypyridine |
|---|---|
| PubChem CID | 84706374 |
| Molecular Formula | C8H10BrNO3 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 4-bromo-2,3,5-trimethoxypyridine |
| SMILES | COc1cnc(OC)c(OC)c1Br |
| InChI | InChI=1S/C8H10BrNO3/c1-11-5-4-10-8(13-3)7(12-2)6(5)9/h4H,1-3H3 |
| InChIKey | NSMUUIZYUYNGES-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |