About 4-bromo-1,5-dimethoxyisoquinoline
4-bromo-1,5-dimethoxyisoquinoline (PubChem CID 84712002) has the molecular formula C11H10BrNO2
and a molecular weight of 268.11 g/mol. Its IUPAC name is 4-bromo-1,5-dimethoxyisoquinoline.
Molecular Properties
| Compound Name | 4-bromo-1,5-dimethoxyisoquinoline |
| PubChem CID | 84712002 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 4-bromo-1,5-dimethoxyisoquinoline |
| SMILES | COc1ncc(Br)c2c(OC)cccc12 |
| InChI | InChI=1S/C11H10BrNO2/c1-14-9-5-3-4-7-10(9)8(12)6-13-11(7)15-2/h3-6H,1-2H3 |
| InChIKey | GIVRKKYQSXIIIG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-1,5-dimethoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,5-dimethoxyisoquinoline?
The IUPAC name of 4-bromo-1,5-dimethoxyisoquinoline (CID 84712002) is 4-bromo-1,5-dimethoxyisoquinoline.
What is the SMILES notation for 4-bromo-1,5-dimethoxyisoquinoline?
The canonical SMILES for 4-bromo-1,5-dimethoxyisoquinoline is COc1ncc(Br)c2c(OC)cccc12.
What is the InChIKey of 4-bromo-1,5-dimethoxyisoquinoline?
The InChIKey is GIVRKKYQSXIIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrNO2/c1-14-9-5-3-4-7-10(9)8(12)6-13-11(7)15-2/h3-6H,1-2H3.
What are the key properties of 4-bromo-1,5-dimethoxyisoquinoline?
4-bromo-1,5-dimethoxyisoquinoline has a molecular weight of 268.11 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,5-dimethoxyisoquinoline is sourced from PubChem (CID 84712002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).