C26H23NO6 — CID 139981000
[1-methoxy-4-(3,4,5-trimethoxyphenyl)isoquinolin-5-yl] benzoate (PubChem CID 139981000) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is [1-methoxy-4-(3,4,5-trimethoxyphenyl)isoquinolin-5-yl] benzoate.
| Compound Name | [1-methoxy-4-(3,4,5-trimethoxyphenyl)isoquinolin-5-yl] benzoate |
|---|---|
| PubChem CID | 139981000 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [1-methoxy-4-(3,4,5-trimethoxyphenyl)isoquinolin-5-yl] benzoate |
| SMILES | COc1cc(-c2cnc(OC)c3cccc(OC(=O)c4ccccc4)c23)cc(OC)c1OC |
| InChI | InChI=1S/C26H23NO6/c1-29-21-13-17(14-22(30-2)24(21)31-3)19-15-27-25(32-4)18-11-8-12-20(23(18)19)33-26(28)16-9-6-5-7-10-16/h5-15H,1-4H3 |
| InChIKey | XFPYRPBZCPANAD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|