C25H22N2O5 — CID 141317691
[1-phenyl-5-(3,4,5-trimethoxyphenyl)pyrazol-3-yl] benzoate (PubChem CID 141317691) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is [1-phenyl-5-(3,4,5-trimethoxyphenyl)pyrazol-3-yl] benzoate.
| Compound Name | [1-phenyl-5-(3,4,5-trimethoxyphenyl)pyrazol-3-yl] benzoate |
|---|---|
| PubChem CID | 141317691 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [1-phenyl-5-(3,4,5-trimethoxyphenyl)pyrazol-3-yl] benzoate |
| SMILES | COc1cc(-c2cc(OC(=O)c3ccccc3)nn2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N2O5/c1-29-21-14-18(15-22(30-2)24(21)31-3)20-16-23(26-27(20)19-12-8-5-9-13-19)32-25(28)17-10-6-4-7-11-17/h4-16H,1-3H3 |
| InChIKey | GQYHJHHWBNMSDU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |