C23H20O6 — CID 2678942
(4-benzoylphenyl) 3,4,5-trimethoxybenzoate (PubChem CID 2678942) has the molecular formula C23H20O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is (4-benzoylphenyl) 3,4,5-trimethoxybenzoate.
| Compound Name | (4-benzoylphenyl) 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2678942 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (4-benzoylphenyl) 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(C(=O)c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20O6/c1-26-19-13-17(14-20(27-2)22(19)28-3)23(25)29-18-11-9-16(10-12-18)21(24)15-7-5-4-6-8-15/h4-14H,1-3H3 |
| InChIKey | FWRSKCKXZZJGTK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|