C24H23NO6 — CID 1193343
[4-[(4-methylphenyl)carbamoyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 1193343) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is [4-[(4-methylphenyl)carbamoyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[(4-methylphenyl)carbamoyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 1193343 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [4-[(4-methylphenyl)carbamoyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(C(=O)Nc3ccc(C)cc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23NO6/c1-15-5-9-18(10-6-15)25-23(26)16-7-11-19(12-8-16)31-24(27)17-13-20(28-2)22(30-4)21(14-17)29-3/h5-14H,1-4H3,(H,25,26) |
| InChIKey | GDEHWWCACMCHHL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|