C17H19NO5 — CID 4198373
4-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 4198373) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 4-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 4198373 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-methoxy-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C17H19NO5/c1-20-13-7-5-11(6-8-13)17(19)18-12-9-14(21-2)16(23-4)15(10-12)22-3/h5-10H,1-4H3,(H,18,19) |
| InChIKey | WUVXRJAWUCTARA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |