C23H22N2O6 — CID 56545250
4-[4-[(3,4,5-trimethoxyphenyl)carbamoyl]phenoxy]benzamide (PubChem CID 56545250) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is 4-[4-[(3,4,5-trimethoxyphenyl)carbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[(3,4,5-trimethoxyphenyl)carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56545250 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-[4-[(3,4,5-trimethoxyphenyl)carbamoyl]phenoxy]benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(Oc3ccc(C(N)=O)cc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H22N2O6/c1-28-19-12-16(13-20(29-2)21(19)30-3)25-23(27)15-6-10-18(11-7-15)31-17-8-4-14(5-9-17)22(24)26/h4-13H,1-3H3,(H2,24,26)(H,25,27) |
| InChIKey | QKOICCMXFOSTRE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |