C17H20N2O4 — CID 28723700
3-amino-4-methyl-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 28723700) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-amino-4-methyl-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 3-amino-4-methyl-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 28723700 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-amino-4-methyl-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(C)c(N)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H20N2O4/c1-10-5-6-11(7-13(10)18)17(20)19-12-8-14(21-2)16(23-4)15(9-12)22-3/h5-9H,18H2,1-4H3,(H,19,20) |
| InChIKey | HZIGIUFDCSIDOF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|