C15H15NO6 — CID 110697559
6-oxo-N-(3,4,5-trimethoxyphenyl)pyran-3-carboxamide (PubChem CID 110697559) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is 6-oxo-N-(3,4,5-trimethoxyphenyl)pyran-3-carboxamide.
| Compound Name | 6-oxo-N-(3,4,5-trimethoxyphenyl)pyran-3-carboxamide |
|---|---|
| PubChem CID | 110697559 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 6-oxo-N-(3,4,5-trimethoxyphenyl)pyran-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(=O)oc2)cc(OC)c1OC |
| InChI | InChI=1S/C15H15NO6/c1-19-11-6-10(7-12(20-2)14(11)21-3)16-15(18)9-4-5-13(17)22-8-9/h4-8H,1-3H3,(H,16,18) |
| InChIKey | XKBKWZVVHGWBSK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |