C14H11NO6 — CID 63744614
4-methoxy-3-[(6-oxopyran-3-carbonyl)amino]benzoic acid (PubChem CID 63744614) has the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. Its IUPAC name is 4-methoxy-3-[(6-oxopyran-3-carbonyl)amino]benzoic acid.
| Compound Name | 4-methoxy-3-[(6-oxopyran-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 63744614 |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 4-methoxy-3-[(6-oxopyran-3-carbonyl)amino]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=O)c1ccc(=O)oc1 |
| InChI | InChI=1S/C14H11NO6/c1-20-11-4-2-8(14(18)19)6-10(11)15-13(17)9-3-5-12(16)21-7-9/h2-7H,1H3,(H,15,17)(H,18,19) |
| InChIKey | QGIIAWXDALXTOI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |