C13H7Cl2NO5 — CID 82811849
3,5-dichloro-4-[(6-oxopyran-3-carbonyl)amino]benzoic acid (PubChem CID 82811849) has the molecular formula C13H7Cl2NO5 and a molecular weight of 328.11 g/mol. Its IUPAC name is 3,5-dichloro-4-[(6-oxopyran-3-carbonyl)amino]benzoic acid.
| Compound Name | 3,5-dichloro-4-[(6-oxopyran-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 82811849 |
| Molecular Formula | C13H7Cl2NO5 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 3,5-dichloro-4-[(6-oxopyran-3-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(NC(=O)c2ccc(=O)oc2)c(Cl)c1 |
| InChI | InChI=1S/C13H7Cl2NO5/c14-8-3-7(13(19)20)4-9(15)11(8)16-12(18)6-1-2-10(17)21-5-6/h1-5H,(H,16,18)(H,19,20) |
| InChIKey | QVXHUCLSTIZYHM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |