C12H7Cl2NO4 — CID 82830924
3,5-dichloro-4-(furan-2-carbonylamino)benzoic acid (PubChem CID 82830924) has the molecular formula C12H7Cl2NO4 and a molecular weight of 300.10 g/mol. Its IUPAC name is 3,5-dichloro-4-(furan-2-carbonylamino)benzoic acid.
| Compound Name | 3,5-dichloro-4-(furan-2-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 82830924 |
| Molecular Formula | C12H7Cl2NO4 |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 3,5-dichloro-4-(furan-2-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(NC(=O)c2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C12H7Cl2NO4/c13-7-4-6(12(17)18)5-8(14)10(7)15-11(16)9-2-1-3-19-9/h1-5H,(H,15,16)(H,17,18) |
| InChIKey | FGNHQXHLHNIQSH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |