C12H8Cl3N3O2S — CID 2817468
1-(furan-2-carbonylamino)-3-(2,4,6-trichlorophenyl)thiourea (PubChem CID 2817468) has the molecular formula C12H8Cl3N3O2S and a molecular weight of 364.64 g/mol. Its IUPAC name is 1-(furan-2-carbonylamino)-3-(2,4,6-trichlorophenyl)thiourea.
| Compound Name | 1-(furan-2-carbonylamino)-3-(2,4,6-trichlorophenyl)thiourea |
|---|---|
| PubChem CID | 2817468 |
| Molecular Formula | C12H8Cl3N3O2S |
| Molecular Weight | 364.64 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | 1-(furan-2-carbonylamino)-3-(2,4,6-trichlorophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1c(Cl)cc(Cl)cc1Cl)c1ccco1 |
| InChI | InChI=1S/C12H8Cl3N3O2S/c13-6-4-7(14)10(8(15)5-6)16-12(21)18-17-11(19)9-2-1-3-20-9/h1-5H,(H,17,19)(H2,16,18,21) |
| InChIKey | ULWDHKKSLPQFGZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.64 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|