C18H15ClN4O2S — CID 57105287
N-[4-[(4-amino-3-chlorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 57105287) has the molecular formula C18H15ClN4O2S and a molecular weight of 386.86 g/mol. Its IUPAC name is N-[4-[(4-amino-3-chlorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(4-amino-3-chlorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 57105287 |
| Molecular Formula | C18H15ClN4O2S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-[4-[(4-amino-3-chlorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | Nc1ccc(NC(=S)Nc2ccc(NC(=O)c3ccco3)cc2)cc1Cl |
| InChI | InChI=1S/C18H15ClN4O2S/c19-14-10-13(7-8-15(14)20)23-18(26)22-12-5-3-11(4-6-12)21-17(24)16-2-1-9-25-16/h1-10H,20H2,(H,21,24)(H2,22,23,26) |
| InChIKey | AHBCNQRBIHKQPG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|