C18H13F2N3O2S — CID 53488888
N-[4-[(3,5-difluorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 53488888) has the molecular formula C18H13F2N3O2S and a molecular weight of 373.38 g/mol. Its IUPAC name is N-[4-[(3,5-difluorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(3,5-difluorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 53488888 |
| Molecular Formula | C18H13F2N3O2S |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-[4-[(3,5-difluorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)Nc2cc(F)cc(F)c2)cc1)c1ccco1 |
| InChI | InChI=1S/C18H13F2N3O2S/c19-11-8-12(20)10-15(9-11)23-18(26)22-14-5-3-13(4-6-14)21-17(24)16-2-1-7-25-16/h1-10H,(H,21,24)(H2,22,23,26) |
| InChIKey | DANUNXDBXJKUDQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|