C20H19ClN4O2S — CID 57243648
N-[4-[[3-chloro-5-(dimethylamino)phenyl]carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 57243648) has the molecular formula C20H19ClN4O2S and a molecular weight of 414.92 g/mol. Its IUPAC name is N-[4-[[3-chloro-5-(dimethylamino)phenyl]carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[3-chloro-5-(dimethylamino)phenyl]carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 57243648 |
| Molecular Formula | C20H19ClN4O2S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | N-[4-[[3-chloro-5-(dimethylamino)phenyl]carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | CN(C)c1cc(Cl)cc(NC(=S)Nc2ccc(NC(=O)c3ccco3)cc2)c1 |
| InChI | InChI=1S/C20H19ClN4O2S/c1-25(2)17-11-13(21)10-16(12-17)24-20(28)23-15-7-5-14(6-8-15)22-19(26)18-4-3-9-27-18/h3-12H,1-2H3,(H,22,26)(H2,23,24,28) |
| InChIKey | TWSPQWDIFAUADA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|