C25H19ClN4O3S — CID 57248454
N-[4-[(4-benzamido-3-chlorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 57248454) has the molecular formula C25H19ClN4O3S and a molecular weight of 490.97 g/mol. Its IUPAC name is N-[4-[(4-benzamido-3-chlorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(4-benzamido-3-chlorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 57248454 |
| Molecular Formula | C25H19ClN4O3S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[4-[(4-benzamido-3-chlorophenyl)carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)Nc2ccc(NC(=O)c3ccco3)cc2)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C25H19ClN4O3S/c26-20-15-19(12-13-21(20)30-23(31)16-5-2-1-3-6-16)29-25(34)28-18-10-8-17(9-11-18)27-24(32)22-7-4-14-33-22/h1-15H,(H,27,32)(H,30,31)(H2,28,29,34) |
| InChIKey | NIUDMQWWCRWWMQ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|