C20H17ClN2O3 — CID 1365415
N-[2-chloro-4-[(3,4-dimethylbenzoyl)amino]phenyl]furan-2-carboxamide (PubChem CID 1365415) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is N-[2-chloro-4-[(3,4-dimethylbenzoyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-chloro-4-[(3,4-dimethylbenzoyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1365415 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[2-chloro-4-[(3,4-dimethylbenzoyl)amino]phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(NC(=O)c3ccco3)c(Cl)c2)cc1C |
| InChI | InChI=1S/C20H17ClN2O3/c1-12-5-6-14(10-13(12)2)19(24)22-15-7-8-17(16(21)11-15)23-20(25)18-4-3-9-26-18/h3-11H,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | HCMMSMBUEPTJKG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |