C11H7Cl2NO2 — CID 3105425
N-(2,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 3105425) has the molecular formula C11H7Cl2NO2 and a molecular weight of 256.09 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3105425 |
| Molecular Formula | C11H7Cl2NO2 |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | N-(2,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1ccco1 |
| InChI | InChI=1S/C11H7Cl2NO2/c12-7-3-4-9(8(13)6-7)14-11(15)10-2-1-5-16-10/h1-6H,(H,14,15) |
| InChIKey | INHZUTJGFJFPRQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |