C19H10ClNO4 — CID 4022142
N-(3-chloro-9,10-dioxoanthracen-2-yl)furan-2-carboxamide (PubChem CID 4022142) has the molecular formula C19H10ClNO4 and a molecular weight of 351.75 g/mol. Its IUPAC name is N-(3-chloro-9,10-dioxoanthracen-2-yl)furan-2-carboxamide.
| Compound Name | N-(3-chloro-9,10-dioxoanthracen-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4022142 |
| Molecular Formula | C19H10ClNO4 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-(3-chloro-9,10-dioxoanthracen-2-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1cc2c(cc1Cl)C(=O)c1ccccc1C2=O)c1ccco1 |
| InChI | InChI=1S/C19H10ClNO4/c20-14-8-12-13(9-15(14)21-19(24)16-6-3-7-25-16)18(23)11-5-2-1-4-10(11)17(12)22/h1-9H,(H,21,24) |
| InChIKey | CFALZSYZCDLOPX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|