C15H12ClN3O4 — CID 22433465
N-(7-chloro-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)furan-2-carboxamide (PubChem CID 22433465) has the molecular formula C15H12ClN3O4 and a molecular weight of 333.73 g/mol. Its IUPAC name is N-(7-chloro-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)furan-2-carboxamide.
| Compound Name | N-(7-chloro-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 22433465 |
| Molecular Formula | C15H12ClN3O4 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(7-chloro-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)furan-2-carboxamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(NC(=O)c3ccco3)c(Cl)cc21 |
| InChI | InChI=1S/C15H12ClN3O4/c1-18-10-6-8(16)9(17-13(20)12-4-3-5-23-12)7-11(10)19(2)15(22)14(18)21/h3-7H,1-2H3,(H,17,20) |
| InChIKey | JLUWGBRNXFIVBR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|