C29H19ClN2O4 — CID 1136457
N-[2-chloro-4-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl]furan-2-carboxamide (PubChem CID 1136457) has the molecular formula C29H19ClN2O4 and a molecular weight of 494.93 g/mol. Its IUPAC name is N-[2-chloro-4-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-chloro-4-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1136457 |
| Molecular Formula | C29H19ClN2O4 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | N-[2-chloro-4-[(15R,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2C(=O)[C@@H]3C4c5ccccc5C(c5ccccc54)[C@H]3C2=O)cc1Cl)c1ccco1 |
| InChI | InChI=1S/C29H19ClN2O4/c30-20-14-15(11-12-21(20)31-27(33)22-10-5-13-36-22)32-28(34)25-23-16-6-1-2-7-17(16)24(26(25)29(32)35)19-9-4-3-8-18(19)23/h1-14,23-26H,(H,31,33)/t23?,24?,25-,26-/m1/s1 |
| InChIKey | VBGUJJKGBWYACH-CVQXOBEKSA-N |
| XLogP | 5.58 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|