C20H12ClN3O4S — CID 3519498
N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 3519498) has the molecular formula C20H12ClN3O4S and a molecular weight of 425.85 g/mol. Its IUPAC name is N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3519498 |
| Molecular Formula | C20H12ClN3O4S |
| Molecular Weight | 425.85 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1Cl)c1ccco1 |
| InChI | InChI=1S/C20H12ClN3O4S/c21-14-10-11(24-18(26)12-4-1-2-5-13(12)19(24)27)7-8-15(14)22-20(29)23-17(25)16-6-3-9-28-16/h1-10H,(H2,22,23,25,29) |
| InChIKey | POTDMWXEHYBEOK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.85 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|