C26H22ClN3O4S — CID 3524960
3-butoxy-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3524960) has the molecular formula C26H22ClN3O4S and a molecular weight of 508.00 g/mol. Its IUPAC name is 3-butoxy-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-butoxy-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3524960 |
| Molecular Formula | C26H22ClN3O4S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 3-butoxy-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2ccc(N3C(=O)c4ccccc4C3=O)cc2Cl)c1 |
| InChI | InChI=1S/C26H22ClN3O4S/c1-2-3-13-34-18-8-6-7-16(14-18)23(31)29-26(35)28-22-12-11-17(15-21(22)27)30-24(32)19-9-4-5-10-20(19)25(30)33/h4-12,14-15H,2-3,13H2,1H3,(H2,28,29,31,35) |
| InChIKey | CJHQEFOQQYCBLS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|