C22H13ClFN3O3S — CID 4626816
N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-fluorobenzamide (PubChem CID 4626816) has the molecular formula C22H13ClFN3O3S and a molecular weight of 453.88 g/mol. Its IUPAC name is N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4626816 |
| Molecular Formula | C22H13ClFN3O3S |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-fluorobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1Cl)c1ccccc1F |
| InChI | InChI=1S/C22H13ClFN3O3S/c23-16-11-12(27-20(29)13-5-1-2-6-14(13)21(27)30)9-10-18(16)25-22(31)26-19(28)15-7-3-4-8-17(15)24/h1-11H,(H2,25,26,28,31) |
| InChIKey | MAGWQOMXXYEJIB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|