About N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide
N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide (PubChem CID 5153626) has the molecular formula C25H15ClN2O3
and a molecular weight of 426.86 g/mol. Its IUPAC name is N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide.
Molecular Properties
| Compound Name | N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide |
| PubChem CID | 5153626 |
| Molecular Formula | C25H15ClN2O3 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H15ClN2O3/c26-21-14-16(28-24(30)19-9-3-4-10-20(19)25(28)31)12-13-22(21)27-23(29)18-11-5-7-15-6-1-2-8-17(15)18/h1-14H,(H,27,29) |
| InChIKey | JWMZABHGASYSSD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide?
The IUPAC name of N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide (CID 5153626) is N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide.
What is the SMILES notation for N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide?
The canonical SMILES for N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide is O=C(Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1Cl)c1cccc2ccccc12.
What is the InChIKey of N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide?
The InChIKey is JWMZABHGASYSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H15ClN2O3/c26-21-14-16(28-24(30)19-9-3-4-10-20(19)25(28)31)12-13-22(21)27-23(29)18-11-5-7-15-6-1-2-8-17(15)18/h1-14H,(H,27,29).
What are the key properties of N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide?
N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide has a molecular weight of 426.86 g/mol, XLogP of 5.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]naphthalene-1-carboxamide is sourced from PubChem (CID 5153626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).