C28H19ClN2O2 — CID 2179861
N-[3-chloro-4-(naphthalene-1-carbonylamino)phenyl]naphthalene-1-carboxamide (PubChem CID 2179861) has the molecular formula C28H19ClN2O2 and a molecular weight of 450.93 g/mol. Its IUPAC name is N-[3-chloro-4-(naphthalene-1-carbonylamino)phenyl]naphthalene-1-carboxamide.
| Compound Name | N-[3-chloro-4-(naphthalene-1-carbonylamino)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 2179861 |
| Molecular Formula | C28H19ClN2O2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[3-chloro-4-(naphthalene-1-carbonylamino)phenyl]naphthalene-1-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2cccc3ccccc23)c(Cl)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H19ClN2O2/c29-25-17-20(30-27(32)23-13-5-9-18-7-1-3-11-21(18)23)15-16-26(25)31-28(33)24-14-6-10-19-8-2-4-12-22(19)24/h1-17H,(H,30,32)(H,31,33) |
| InChIKey | WBWJBRYEXMROJC-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |