C19H16ClNO3 — CID 823910
N-(5-chloro-2,4-dimethoxyphenyl)naphthalene-1-carboxamide (PubChem CID 823910) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)naphthalene-1-carboxamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 823910 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)naphthalene-1-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2cccc3ccccc23)cc1Cl |
| InChI | InChI=1S/C19H16ClNO3/c1-23-17-11-18(24-2)16(10-15(17)20)21-19(22)14-9-5-7-12-6-3-4-8-13(12)14/h3-11H,1-2H3,(H,21,22) |
| InChIKey | AAOMTOLCSIHZLA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |