C19H15ClNNaO4 — CID 23668732
sodium 3-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl]naphthalen-2-olate (PubChem CID 23668732) has the molecular formula C19H15ClNNaO4 and a molecular weight of 379.78 g/mol. Its IUPAC name is sodium 3-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl]naphthalen-2-olate.
| Compound Name | sodium 3-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl]naphthalen-2-olate |
|---|---|
| PubChem CID | 23668732 |
| Molecular Formula | C19H15ClNNaO4 |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | sodium 3-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl]naphthalen-2-olate |
| SMILES | COc1cc(OC)c(NC(=O)c2cc3ccccc3cc2[O-])cc1Cl.[Na+] |
| InChI | InChI=1S/C19H16ClNO4.Na/c1-24-17-10-18(25-2)15(9-14(17)20)21-19(23)13-7-11-5-3-4-6-12(11)8-16(13)22;/h3-10,22H,1-2H3,(H,21,23);/q;+1/p-1 |
| InChIKey | BSWGMVDYIKKXDX-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |