C19H16ClKNO3 — CID 90477654
CID 90477654 (PubChem CID 90477654) has the molecular formula C19H16ClKNO3 and a molecular weight of 380.89 g/mol.
| Compound Name | CID 90477654 |
|---|---|
| PubChem CID | 90477654 |
| Molecular Formula | C19H16ClKNO3 |
| Molecular Weight | 380.89 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | — |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)c1cc2ccccc2cc1O.[K] |
| InChI | InChI=1S/C19H16ClNO3.K/c1-11-7-16(18(24-2)10-15(11)20)21-19(23)14-8-12-5-3-4-6-13(12)9-17(14)22;/h3-10,22H,1-2H3,(H,21,23); |
| InChIKey | PKLJFPWYPMRILA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |