C15H14ClNO4 — CID 107688924
N-(4-chloro-2-methoxy-5-methylphenyl)-2,6-dihydroxybenzamide (PubChem CID 107688924) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-2,6-dihydroxybenzamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 107688924 |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2,6-dihydroxybenzamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C15H14ClNO4/c1-8-6-10(13(21-2)7-9(8)16)17-15(20)14-11(18)4-3-5-12(14)19/h3-7,18-19H,1-2H3,(H,17,20) |
| InChIKey | XPWOGDYRELTEPJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |