C16H13Cl3N2O3 — CID 108532298
N-(4-chloro-2-methoxy-5-methylphenyl)-N'-(2,6-dichlorophenyl)oxamide (PubChem CID 108532298) has the molecular formula C16H13Cl3N2O3 and a molecular weight of 387.65 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-N'-(2,6-dichlorophenyl)oxamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-N'-(2,6-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 108532298 |
| Molecular Formula | C16H13Cl3N2O3 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-N'-(2,6-dichlorophenyl)oxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl3N2O3/c1-8-6-12(13(24-2)7-11(8)19)20-15(22)16(23)21-14-9(17)4-3-5-10(14)18/h3-7H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | WXSHEFRNJDRHHO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|