C18H18Cl2N2O5 — CID 108532266
N-(4-chloro-2,5-dimethoxyphenyl)-N'-(4-chloro-2-methoxy-5-methylphenyl)oxamide (PubChem CID 108532266) has the molecular formula C18H18Cl2N2O5 and a molecular weight of 413.26 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-N'-(4-chloro-2-methoxy-5-methylphenyl)oxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-N'-(4-chloro-2-methoxy-5-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108532266 |
| Molecular Formula | C18H18Cl2N2O5 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-N'-(4-chloro-2-methoxy-5-methylphenyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)Nc2cc(C)c(Cl)cc2OC)c(OC)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O5/c1-9-5-12(15(26-3)6-10(9)19)21-17(23)18(24)22-13-8-14(25-2)11(20)7-16(13)27-4/h5-8H,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | RVBKYDBRMTYMEZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|