C16H15ClN2O5 — CID 108514378
N'-(4-chloro-2,5-dimethoxyphenyl)-N-(2-hydroxyphenyl)oxamide (PubChem CID 108514378) has the molecular formula C16H15ClN2O5 and a molecular weight of 350.76 g/mol. Its IUPAC name is N'-(4-chloro-2,5-dimethoxyphenyl)-N-(2-hydroxyphenyl)oxamide.
| Compound Name | N'-(4-chloro-2,5-dimethoxyphenyl)-N-(2-hydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 108514378 |
| Molecular Formula | C16H15ClN2O5 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N'-(4-chloro-2,5-dimethoxyphenyl)-N-(2-hydroxyphenyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)Nc2ccccc2O)c(OC)cc1Cl |
| InChI | InChI=1S/C16H15ClN2O5/c1-23-13-8-11(14(24-2)7-9(13)17)19-16(22)15(21)18-10-5-3-4-6-12(10)20/h3-8,20H,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | BXTMHXNEWFYQDF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|