C22H19ClN2O5 — CID 108511701
N'-(4-chloro-2,5-dimethoxyphenyl)-N-(4-phenoxyphenyl)oxamide (PubChem CID 108511701) has the molecular formula C22H19ClN2O5 and a molecular weight of 426.86 g/mol. Its IUPAC name is N'-(4-chloro-2,5-dimethoxyphenyl)-N-(4-phenoxyphenyl)oxamide.
| Compound Name | N'-(4-chloro-2,5-dimethoxyphenyl)-N-(4-phenoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108511701 |
| Molecular Formula | C22H19ClN2O5 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N'-(4-chloro-2,5-dimethoxyphenyl)-N-(4-phenoxyphenyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)Nc2ccc(Oc3ccccc3)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C22H19ClN2O5/c1-28-19-13-18(20(29-2)12-17(19)23)25-22(27)21(26)24-14-8-10-16(11-9-14)30-15-6-4-3-5-7-15/h3-13H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | XSUPQGPVSRLFQZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|