C24H24N2O5 — CID 108510015
N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(4-phenoxyphenyl)oxamide (PubChem CID 108510015) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(4-phenoxyphenyl)oxamide.
| Compound Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(4-phenoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108510015 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(4-phenoxyphenyl)oxamide |
| SMILES | COc1ccc(C(C)NC(=O)C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C24H24N2O5/c1-16(17-9-14-21(29-2)22(15-17)30-3)25-23(27)24(28)26-18-10-12-20(13-11-18)31-19-7-5-4-6-8-19/h4-16H,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | JDIRURDESLRGLG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|