C22H22N2O4 — CID 108510137
N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-naphthalen-2-yloxamide (PubChem CID 108510137) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-naphthalen-2-yloxamide.
| Compound Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-naphthalen-2-yloxamide |
|---|---|
| PubChem CID | 108510137 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-naphthalen-2-yloxamide |
| SMILES | COc1ccc(C(C)NC(=O)C(=O)Nc2ccc3ccccc3c2)cc1OC |
| InChI | InChI=1S/C22H22N2O4/c1-14(16-9-11-19(27-2)20(13-16)28-3)23-21(25)22(26)24-18-10-8-15-6-4-5-7-17(15)12-18/h4-14H,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | JFLKGCLWCKGDOK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|