C15H22N2O5 — CID 108510076
N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(2-hydroxypropyl)oxamide (PubChem CID 108510076) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(2-hydroxypropyl)oxamide.
| Compound Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(2-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 108510076 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(2-hydroxypropyl)oxamide |
| SMILES | COc1ccc(C(C)NC(=O)C(=O)NCC(C)O)cc1OC |
| InChI | InChI=1S/C15H22N2O5/c1-9(18)8-16-14(19)15(20)17-10(2)11-5-6-12(21-3)13(7-11)22-4/h5-7,9-10,18H,8H2,1-4H3,(H,16,19)(H,17,20) |
| InChIKey | PDOUKQNFGZTCCB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|