C19H24N2O5 — CID 108892136
1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(2-methoxyphenoxy)methyl]urea (PubChem CID 108892136) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(2-methoxyphenoxy)methyl]urea.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(2-methoxyphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108892136 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[(2-methoxyphenoxy)methyl]urea |
| SMILES | COc1ccc(C(C)NC(=O)NCOc2ccccc2OC)cc1OC |
| InChI | InChI=1S/C19H24N2O5/c1-13(14-9-10-16(24-3)18(11-14)25-4)21-19(22)20-12-26-17-8-6-5-7-15(17)23-2/h5-11,13H,12H2,1-4H3,(H2,20,21,22) |
| InChIKey | PIEFAIHCAYLGAH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|